About 2-aminoacetic acid;barium(2+);hydride
2-aminoacetic acid;barium(2+);hydride (PubChem CID 173122001) has the molecular formula C2H7BaNO2
and a molecular weight of 214.41 g/mol. Its IUPAC name is 2-aminoacetic acid;barium(2+);hydride.
Molecular Properties
| Compound Name | 2-aminoacetic acid;barium(2+);hydride |
| PubChem CID | 173122001 |
| Molecular Formula | C2H7BaNO2 |
| Molecular Weight | 214.41 g/mol |
| Exact Mass | 214.95 |
| IUPAC Name | 2-aminoacetic acid;barium(2+);hydride |
| SMILES | NCC(=O)O.[Ba+2].[H-].[H-] |
| InChI | InChI=1S/C2H5NO2.Ba.2H/c3-1-2(4)5;;;/h1,3H2,(H,4,5);;;/q;+2;2*-1 |
| InChIKey | MDIHJEPMLGHFKZ-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.41 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-aminoacetic acid;barium(2+);hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;barium(2+);hydride?
The IUPAC name of 2-aminoacetic acid;barium(2+);hydride (CID 173122001) is 2-aminoacetic acid;barium(2+);hydride.
What is the SMILES notation for 2-aminoacetic acid;barium(2+);hydride?
The canonical SMILES for 2-aminoacetic acid;barium(2+);hydride is NCC(=O)O.[Ba+2].[H-].[H-].
What is the InChIKey of 2-aminoacetic acid;barium(2+);hydride?
The InChIKey is MDIHJEPMLGHFKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.Ba.2H/c3-1-2(4)5;;;/h1,3H2,(H,4,5);;;/q;+2;2*-1.
What are the key properties of 2-aminoacetic acid;barium(2+);hydride?
2-aminoacetic acid;barium(2+);hydride has a molecular weight of 214.41 g/mol, XLogP of -1.13, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;barium(2+);hydride is sourced from PubChem (CID 173122001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).