About 2-aminoacetic acid;cadmium
2-aminoacetic acid;cadmium (PubChem CID 87269769) has the molecular formula C2H5CdNO2
and a molecular weight of 187.48 g/mol. Its IUPAC name is 2-aminoacetic acid;cadmium.
Molecular Properties
| Compound Name | 2-aminoacetic acid;cadmium |
| PubChem CID | 87269769 |
| Molecular Formula | C2H5CdNO2 |
| Molecular Weight | 187.48 g/mol |
| Exact Mass | 188.94 |
| IUPAC Name | 2-aminoacetic acid;cadmium |
| SMILES | NCC(=O)O.[Cd] |
| InChI | InChI=1S/C2H5NO2.Cd/c3-1-2(4)5;/h1,3H2,(H,4,5); |
| InChIKey | WOKVYZPDWVEQED-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.48 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-aminoacetic acid;cadmium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;cadmium?
The IUPAC name of 2-aminoacetic acid;cadmium (CID 87269769) is 2-aminoacetic acid;cadmium.
What is the SMILES notation for 2-aminoacetic acid;cadmium?
The canonical SMILES for 2-aminoacetic acid;cadmium is NCC(=O)O.[Cd].
What is the InChIKey of 2-aminoacetic acid;cadmium?
The InChIKey is WOKVYZPDWVEQED-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.Cd/c3-1-2(4)5;/h1,3H2,(H,4,5);.
What are the key properties of 2-aminoacetic acid;cadmium?
2-aminoacetic acid;cadmium has a molecular weight of 187.48 g/mol, XLogP of -0.97, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;cadmium is sourced from PubChem (CID 87269769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).