About 2-aminoacetic acid;azane;ethene
2-aminoacetic acid;azane;ethene (PubChem CID 174860038) has the molecular formula C4H12N2O2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 2-aminoacetic acid;azane;ethene.
Molecular Properties
| Compound Name | 2-aminoacetic acid;azane;ethene |
| PubChem CID | 174860038 |
| Molecular Formula | C4H12N2O2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | 2-aminoacetic acid;azane;ethene |
| SMILES | C=C.N.NCC(=O)O |
| InChI | InChI=1S/C2H5NO2.C2H4.H3N/c3-1-2(4)5;1-2;/h1,3H2,(H,4,5);1-2H2;1H3 |
| InChIKey | FPVWCCPXLMKVIN-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoacetic acid;azane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;azane;ethene?
The IUPAC name of 2-aminoacetic acid;azane;ethene (CID 174860038) is 2-aminoacetic acid;azane;ethene.
What is the SMILES notation for 2-aminoacetic acid;azane;ethene?
The canonical SMILES for 2-aminoacetic acid;azane;ethene is C=C.N.NCC(=O)O.
What is the InChIKey of 2-aminoacetic acid;azane;ethene?
The InChIKey is FPVWCCPXLMKVIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.C2H4.H3N/c3-1-2(4)5;1-2;/h1,3H2,(H,4,5);1-2H2;1H3.
What are the key properties of 2-aminoacetic acid;azane;ethene?
2-aminoacetic acid;azane;ethene has a molecular weight of 120.15 g/mol, XLogP of -0.01, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;azane;ethene is sourced from PubChem (CID 174860038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).