About 2-aminoacetic acid;oxocopper
2-aminoacetic acid;oxocopper (PubChem CID 158791680) has the molecular formula C2H5CuNO3
and a molecular weight of 154.61 g/mol. Its IUPAC name is 2-aminoacetic acid;oxocopper.
Molecular Properties
| Compound Name | 2-aminoacetic acid;oxocopper |
| PubChem CID | 158791680 |
| Molecular Formula | C2H5CuNO3 |
| Molecular Weight | 154.61 g/mol |
| Exact Mass | 153.96 |
| IUPAC Name | 2-aminoacetic acid;oxocopper |
| SMILES | NCC(=O)O.O=[Cu] |
| InChI | InChI=1S/C2H5NO2.Cu.O/c3-1-2(4)5;;/h1,3H2,(H,4,5);; |
| InChIKey | ISIWCHJRQBIPNN-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.61 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminoacetic acid;oxocopper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;oxocopper?
The IUPAC name of 2-aminoacetic acid;oxocopper (CID 158791680) is 2-aminoacetic acid;oxocopper.
What is the SMILES notation for 2-aminoacetic acid;oxocopper?
The canonical SMILES for 2-aminoacetic acid;oxocopper is NCC(=O)O.O=[Cu].
What is the InChIKey of 2-aminoacetic acid;oxocopper?
The InChIKey is ISIWCHJRQBIPNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.Cu.O/c3-1-2(4)5;;/h1,3H2,(H,4,5);;.
What are the key properties of 2-aminoacetic acid;oxocopper?
2-aminoacetic acid;oxocopper has a molecular weight of 154.61 g/mol, XLogP of -1.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;oxocopper is sourced from PubChem (CID 158791680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).