About magnesium;2-aminoacetic acid;diacetate
magnesium;2-aminoacetic acid;diacetate (PubChem CID 172709967) has the molecular formula C6H11MgNO6
and a molecular weight of 217.46 g/mol. Its IUPAC name is magnesium;2-aminoacetic acid;diacetate.
Molecular Properties
| Compound Name | magnesium;2-aminoacetic acid;diacetate |
| PubChem CID | 172709967 |
| Molecular Formula | C6H11MgNO6 |
| Molecular Weight | 217.46 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | magnesium;2-aminoacetic acid;diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].NCC(=O)O.[Mg+2] |
| InChI | InChI=1S/C2H5NO2.2C2H4O2.Mg/c3-1-2(4)5;2*1-2(3)4;/h1,3H2,(H,4,5);2*1H3,(H,3,4);/q;;;+2/p-2 |
| InChIKey | FCPXGQYSEJFCGW-UHFFFAOYSA-L |
| XLogP | -3.84 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.46 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze magnesium;2-aminoacetic acid;diacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2-aminoacetic acid;diacetate?
The IUPAC name of magnesium;2-aminoacetic acid;diacetate (CID 172709967) is magnesium;2-aminoacetic acid;diacetate.
What is the SMILES notation for magnesium;2-aminoacetic acid;diacetate?
The canonical SMILES for magnesium;2-aminoacetic acid;diacetate is CC(=O)[O-].CC(=O)[O-].NCC(=O)O.[Mg+2].
What is the InChIKey of magnesium;2-aminoacetic acid;diacetate?
The InChIKey is FCPXGQYSEJFCGW-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H5NO2.2C2H4O2.Mg/c3-1-2(4)5;2*1-2(3)4;/h1,3H2,(H,4,5);2*1H3,(H,3,4);/q;;;+2/p-2.
What are the key properties of magnesium;2-aminoacetic acid;diacetate?
magnesium;2-aminoacetic acid;diacetate has a molecular weight of 217.46 g/mol, XLogP of -3.84, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2-aminoacetic acid;diacetate is sourced from PubChem (CID 172709967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).