About trisodium;2-aminoacetate;diacetate
trisodium;2-aminoacetate;diacetate (PubChem CID 20975811) has the molecular formula C6H10NNa3O6
and a molecular weight of 261.12 g/mol. Its IUPAC name is trisodium;2-aminoacetate;diacetate.
Molecular Properties
| Compound Name | trisodium;2-aminoacetate;diacetate |
| PubChem CID | 20975811 |
| Molecular Formula | C6H10NNa3O6 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | trisodium;2-aminoacetate;diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].NCC(=O)[O-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C2H5NO2.2C2H4O2.3Na/c3-1-2(4)5;2*1-2(3)4;;;/h1,3H2,(H,4,5);2*1H3,(H,3,4);;;/q;;;3*+1/p-3 |
| InChIKey | QKUVCPSLBBFCQV-UHFFFAOYSA-K |
| XLogP | -13.78 |
| TPSA | 146.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | -13.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze trisodium;2-aminoacetate;diacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;2-aminoacetate;diacetate?
The IUPAC name of trisodium;2-aminoacetate;diacetate (CID 20975811) is trisodium;2-aminoacetate;diacetate.
What is the SMILES notation for trisodium;2-aminoacetate;diacetate?
The canonical SMILES for trisodium;2-aminoacetate;diacetate is CC(=O)[O-].CC(=O)[O-].NCC(=O)[O-].[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;2-aminoacetate;diacetate?
The InChIKey is QKUVCPSLBBFCQV-UHFFFAOYSA-K. The full InChI is InChI=1S/C2H5NO2.2C2H4O2.3Na/c3-1-2(4)5;2*1-2(3)4;;;/h1,3H2,(H,4,5);2*1H3,(H,3,4);;;/q;;;3*+1/p-3.
What are the key properties of trisodium;2-aminoacetate;diacetate?
trisodium;2-aminoacetate;diacetate has a molecular weight of 261.12 g/mol, XLogP of -13.78, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;2-aminoacetate;diacetate is sourced from PubChem (CID 20975811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).