About 2-aminoacetate;iron(3+);diacetate
2-aminoacetate;iron(3+);diacetate (PubChem CID 174987571) has the molecular formula C6H10FeNO6
and a molecular weight of 247.99 g/mol. Its IUPAC name is 2-aminoacetate;iron(3+);diacetate.
Molecular Properties
| Compound Name | 2-aminoacetate;iron(3+);diacetate |
| PubChem CID | 174987571 |
| Molecular Formula | C6H10FeNO6 |
| Molecular Weight | 247.99 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 2-aminoacetate;iron(3+);diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].NCC(=O)[O-].[Fe+3] |
| InChI | InChI=1S/C2H5NO2.2C2H4O2.Fe/c3-1-2(4)5;2*1-2(3)4;/h1,3H2,(H,4,5);2*1H3,(H,3,4);/q;;;+3/p-3 |
| InChIKey | RDLHSPYTDTWIFS-UHFFFAOYSA-K |
| XLogP | -4.80 |
| TPSA | 146.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.99 |
| LogP ≤ 5 | -4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoacetate;iron(3+);diacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetate;iron(3+);diacetate?
The IUPAC name of 2-aminoacetate;iron(3+);diacetate (CID 174987571) is 2-aminoacetate;iron(3+);diacetate.
What is the SMILES notation for 2-aminoacetate;iron(3+);diacetate?
The canonical SMILES for 2-aminoacetate;iron(3+);diacetate is CC(=O)[O-].CC(=O)[O-].NCC(=O)[O-].[Fe+3].
What is the InChIKey of 2-aminoacetate;iron(3+);diacetate?
The InChIKey is RDLHSPYTDTWIFS-UHFFFAOYSA-K. The full InChI is InChI=1S/C2H5NO2.2C2H4O2.Fe/c3-1-2(4)5;2*1-2(3)4;/h1,3H2,(H,4,5);2*1H3,(H,3,4);/q;;;+3/p-3.
What are the key properties of 2-aminoacetate;iron(3+);diacetate?
2-aminoacetate;iron(3+);diacetate has a molecular weight of 247.99 g/mol, XLogP of -4.80, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetate;iron(3+);diacetate is sourced from PubChem (CID 174987571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).