About 2-aminoacetate;rubidium(1+)
2-aminoacetate;rubidium(1+) (PubChem CID 59119233) has the molecular formula C2H4NO2Rb
and a molecular weight of 159.53 g/mol. Its IUPAC name is 2-aminoacetate;rubidium(1+).
Molecular Properties
| Compound Name | 2-aminoacetate;rubidium(1+) |
| PubChem CID | 59119233 |
| Molecular Formula | C2H4NO2Rb |
| Molecular Weight | 159.53 g/mol |
| Exact Mass | 158.94 |
| IUPAC Name | 2-aminoacetate;rubidium(1+) |
| SMILES | NCC(=O)[O-].[Rb+] |
| InChI | InChI=1S/C2H5NO2.Rb/c3-1-2(4)5;/h1,3H2,(H,4,5);/q;+1/p-1 |
| InChIKey | PYUYQCHVADOORD-UHFFFAOYSA-M |
| XLogP | -5.30 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.53 |
| LogP ≤ 5 | -5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminoacetate;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetate;rubidium(1+)?
The IUPAC name of 2-aminoacetate;rubidium(1+) (CID 59119233) is 2-aminoacetate;rubidium(1+).
What is the SMILES notation for 2-aminoacetate;rubidium(1+)?
The canonical SMILES for 2-aminoacetate;rubidium(1+) is NCC(=O)[O-].[Rb+].
What is the InChIKey of 2-aminoacetate;rubidium(1+)?
The InChIKey is PYUYQCHVADOORD-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H5NO2.Rb/c3-1-2(4)5;/h1,3H2,(H,4,5);/q;+1/p-1.
What are the key properties of 2-aminoacetate;rubidium(1+)?
2-aminoacetate;rubidium(1+) has a molecular weight of 159.53 g/mol, XLogP of -5.30, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetate;rubidium(1+) is sourced from PubChem (CID 59119233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).