About sodium;2-aminoacetate;methanol
sodium;2-aminoacetate;methanol (PubChem CID 175901893) has the molecular formula C4H12NNaO4
and a molecular weight of 161.13 g/mol. Its IUPAC name is sodium;2-aminoacetate;methanol.
Molecular Properties
| Compound Name | sodium;2-aminoacetate;methanol |
| PubChem CID | 175901893 |
| Molecular Formula | C4H12NNaO4 |
| Molecular Weight | 161.13 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | sodium;2-aminoacetate;methanol |
| SMILES | CO.CO.NCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C2H5NO2.2CH4O.Na/c3-1-2(4)5;2*1-2;/h1,3H2,(H,4,5);2*2H,1H3;/q;;;+1/p-1 |
| InChIKey | PJTLVUUNDPPMKQ-UHFFFAOYSA-M |
| XLogP | -6.08 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.13 |
| LogP ≤ 5 | -6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze sodium;2-aminoacetate;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-aminoacetate;methanol?
The IUPAC name of sodium;2-aminoacetate;methanol (CID 175901893) is sodium;2-aminoacetate;methanol.
What is the SMILES notation for sodium;2-aminoacetate;methanol?
The canonical SMILES for sodium;2-aminoacetate;methanol is CO.CO.NCC(=O)[O-].[Na+].
What is the InChIKey of sodium;2-aminoacetate;methanol?
The InChIKey is PJTLVUUNDPPMKQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H5NO2.2CH4O.Na/c3-1-2(4)5;2*1-2;/h1,3H2,(H,4,5);2*2H,1H3;/q;;;+1/p-1.
What are the key properties of sodium;2-aminoacetate;methanol?
sodium;2-aminoacetate;methanol has a molecular weight of 161.13 g/mol, XLogP of -6.08, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-aminoacetate;methanol is sourced from PubChem (CID 175901893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).