About 2-aminoacetate;ethylazanium
2-aminoacetate;ethylazanium (PubChem CID 87377737) has the molecular formula C4H12N2O2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 2-aminoacetate;ethylazanium.
Molecular Properties
| Compound Name | 2-aminoacetate;ethylazanium |
| PubChem CID | 87377737 |
| Molecular Formula | C4H12N2O2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | 2-aminoacetate;ethylazanium |
| SMILES | CC[NH3+].NCC(=O)[O-] |
| InChI | InChI=1S/C2H5NO2.C2H7N/c3-1-2(4)5;1-2-3/h1,3H2,(H,4,5);2-3H2,1H3 |
| InChIKey | NOAWEQXHZMHMLN-UHFFFAOYSA-N |
| XLogP | -3.06 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminoacetate;ethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetate;ethylazanium?
The IUPAC name of 2-aminoacetate;ethylazanium (CID 87377737) is 2-aminoacetate;ethylazanium.
What is the SMILES notation for 2-aminoacetate;ethylazanium?
The canonical SMILES for 2-aminoacetate;ethylazanium is CC[NH3+].NCC(=O)[O-].
What is the InChIKey of 2-aminoacetate;ethylazanium?
The InChIKey is NOAWEQXHZMHMLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.C2H7N/c3-1-2(4)5;1-2-3/h1,3H2,(H,4,5);2-3H2,1H3.
What are the key properties of 2-aminoacetate;ethylazanium?
2-aminoacetate;ethylazanium has a molecular weight of 120.15 g/mol, XLogP of -3.06, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetate;ethylazanium is sourced from PubChem (CID 87377737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).