About 2-aminoacetate;2-aminoacetic acid;copper(1+)
2-aminoacetate;2-aminoacetic acid;copper(1+) (PubChem CID 156597297) has the molecular formula C4H9CuN2O4
and a molecular weight of 212.67 g/mol. Its IUPAC name is 2-aminoacetate;2-aminoacetic acid;copper(1+).
Molecular Properties
| Compound Name | 2-aminoacetate;2-aminoacetic acid;copper(1+) |
| PubChem CID | 156597297 |
| Molecular Formula | C4H9CuN2O4 |
| Molecular Weight | 212.67 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 2-aminoacetate;2-aminoacetic acid;copper(1+) |
| SMILES | NCC(=O)O.NCC(=O)[O-].[Cu+] |
| InChI | InChI=1S/2C2H5NO2.Cu/c2*3-1-2(4)5;/h2*1,3H2,(H,4,5);/q;;+1/p-1 |
| InChIKey | RQTVXJVCABMLFQ-UHFFFAOYSA-M |
| XLogP | -3.28 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.67 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-aminoacetate;2-aminoacetic acid;copper(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetate;2-aminoacetic acid;copper(1+)?
The IUPAC name of 2-aminoacetate;2-aminoacetic acid;copper(1+) (CID 156597297) is 2-aminoacetate;2-aminoacetic acid;copper(1+).
What is the SMILES notation for 2-aminoacetate;2-aminoacetic acid;copper(1+)?
The canonical SMILES for 2-aminoacetate;2-aminoacetic acid;copper(1+) is NCC(=O)O.NCC(=O)[O-].[Cu+].
What is the InChIKey of 2-aminoacetate;2-aminoacetic acid;copper(1+)?
The InChIKey is RQTVXJVCABMLFQ-UHFFFAOYSA-M. The full InChI is InChI=1S/2C2H5NO2.Cu/c2*3-1-2(4)5;/h2*1,3H2,(H,4,5);/q;;+1/p-1.
What are the key properties of 2-aminoacetate;2-aminoacetic acid;copper(1+)?
2-aminoacetate;2-aminoacetic acid;copper(1+) has a molecular weight of 212.67 g/mol, XLogP of -3.28, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetate;2-aminoacetic acid;copper(1+) is sourced from PubChem (CID 156597297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).