About sodium;2-aminoacetic acid;methylsilanide
sodium;2-aminoacetic acid;methylsilanide (PubChem CID 174830355) has the molecular formula C3H10NNaO2Si
and a molecular weight of 143.19 g/mol. Its IUPAC name is sodium;2-aminoacetic acid;methylsilanide.
Molecular Properties
| Compound Name | sodium;2-aminoacetic acid;methylsilanide |
| PubChem CID | 174830355 |
| Molecular Formula | C3H10NNaO2Si |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | sodium;2-aminoacetic acid;methylsilanide |
| SMILES | C[SiH2-].NCC(=O)O.[Na+] |
| InChI | InChI=1S/C2H5NO2.CH5Si.Na/c3-1-2(4)5;1-2;/h1,3H2,(H,4,5);2H2,1H3;/q;-1;+1 |
| InChIKey | BSCVYFWWUNELJY-UHFFFAOYSA-N |
| XLogP | -4.30 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-aminoacetic acid;methylsilanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-aminoacetic acid;methylsilanide?
The IUPAC name of sodium;2-aminoacetic acid;methylsilanide (CID 174830355) is sodium;2-aminoacetic acid;methylsilanide.
What is the SMILES notation for sodium;2-aminoacetic acid;methylsilanide?
The canonical SMILES for sodium;2-aminoacetic acid;methylsilanide is C[SiH2-].NCC(=O)O.[Na+].
What is the InChIKey of sodium;2-aminoacetic acid;methylsilanide?
The InChIKey is BSCVYFWWUNELJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.CH5Si.Na/c3-1-2(4)5;1-2;/h1,3H2,(H,4,5);2H2,1H3;/q;-1;+1.
What are the key properties of sodium;2-aminoacetic acid;methylsilanide?
sodium;2-aminoacetic acid;methylsilanide has a molecular weight of 143.19 g/mol, XLogP of -4.30, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-aminoacetic acid;methylsilanide is sourced from PubChem (CID 174830355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).