C8H20N4O4 — CID 159632012
acetic acid;2-(dimethylamino)propanoic acid;guanidine (PubChem CID 159632012) has the molecular formula C8H20N4O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is acetic acid;2-(dimethylamino)propanoic acid;guanidine.
| Compound Name | acetic acid;2-(dimethylamino)propanoic acid;guanidine |
|---|---|
| PubChem CID | 159632012 |
| Molecular Formula | C8H20N4O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | acetic acid;2-(dimethylamino)propanoic acid;guanidine |
| SMILES | CC(=O)O.CC(C(=O)O)N(C)C.[H]N=C(N)N |
| InChI | InChI=1S/C5H11NO2.C2H4O2.CH5N3/c1-4(5(7)8)6(2)3;1-2(3)4;2-1(3)4/h4H,1-3H3,(H,7,8);1H3,(H,3,4);(H5,2,3,4) |
| InChIKey | LTCONFWJYQYKGX-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 153.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|