About 2-(dimethylamino)propanoic acid;2-(trimethylazaniumyl)acetate
2-(dimethylamino)propanoic acid;2-(trimethylazaniumyl)acetate (PubChem CID 166644612) has the molecular formula C10H22N2O4
and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-(dimethylamino)propanoic acid;2-(trimethylazaniumyl)acetate.
Molecular Properties
| Compound Name | 2-(dimethylamino)propanoic acid;2-(trimethylazaniumyl)acetate |
| PubChem CID | 166644612 |
| Molecular Formula | C10H22N2O4 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 2-(dimethylamino)propanoic acid;2-(trimethylazaniumyl)acetate |
| SMILES | CC(C(=O)O)N(C)C.C[N+](C)(C)CC(=O)[O-] |
| InChI | InChI=1S/2C5H11NO2/c1-6(2,3)4-5(7)8;1-4(5(7)8)6(2)3/h4H2,1-3H3;4H,1-3H3,(H,7,8) |
| InChIKey | CVGQHKSMGJWLKO-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)propanoic acid;2-(trimethylazaniumyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)propanoic acid;2-(trimethylazaniumyl)acetate?
The IUPAC name of 2-(dimethylamino)propanoic acid;2-(trimethylazaniumyl)acetate (CID 166644612) is 2-(dimethylamino)propanoic acid;2-(trimethylazaniumyl)acetate.
What is the SMILES notation for 2-(dimethylamino)propanoic acid;2-(trimethylazaniumyl)acetate?
The canonical SMILES for 2-(dimethylamino)propanoic acid;2-(trimethylazaniumyl)acetate is CC(C(=O)O)N(C)C.C[N+](C)(C)CC(=O)[O-].
What is the InChIKey of 2-(dimethylamino)propanoic acid;2-(trimethylazaniumyl)acetate?
The InChIKey is CVGQHKSMGJWLKO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H11NO2/c1-6(2,3)4-5(7)8;1-4(5(7)8)6(2)3/h4H2,1-3H3;4H,1-3H3,(H,7,8).
What are the key properties of 2-(dimethylamino)propanoic acid;2-(trimethylazaniumyl)acetate?
2-(dimethylamino)propanoic acid;2-(trimethylazaniumyl)acetate has a molecular weight of 234.30 g/mol, XLogP of -1.54, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)propanoic acid;2-(trimethylazaniumyl)acetate is sourced from PubChem (CID 166644612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).