About dimethylazanium;2-(trimethylazaniumyl)acetate
dimethylazanium;2-(trimethylazaniumyl)acetate (PubChem CID 22558275) has the molecular formula C7H19N2O2+
and a molecular weight of 163.24 g/mol. Its IUPAC name is dimethylazanium;2-(trimethylazaniumyl)acetate.
Molecular Properties
| Compound Name | dimethylazanium;2-(trimethylazaniumyl)acetate |
| PubChem CID | 22558275 |
| Molecular Formula | C7H19N2O2+ |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | dimethylazanium;2-(trimethylazaniumyl)acetate |
| SMILES | C[N+](C)(C)CC(=O)[O-].C[NH2+]C |
| InChI | InChI=1S/C5H11NO2.C2H7N/c1-6(2,3)4-5(7)8;1-3-2/h4H2,1-3H3;3H,1-2H3/p+1 |
| InChIKey | GHQUPYSMGYSTJT-UHFFFAOYSA-O |
| XLogP | -2.75 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dimethylazanium;2-(trimethylazaniumyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylazanium;2-(trimethylazaniumyl)acetate?
The IUPAC name of dimethylazanium;2-(trimethylazaniumyl)acetate (CID 22558275) is dimethylazanium;2-(trimethylazaniumyl)acetate.
What is the SMILES notation for dimethylazanium;2-(trimethylazaniumyl)acetate?
The canonical SMILES for dimethylazanium;2-(trimethylazaniumyl)acetate is C[N+](C)(C)CC(=O)[O-].C[NH2+]C.
What is the InChIKey of dimethylazanium;2-(trimethylazaniumyl)acetate?
The InChIKey is GHQUPYSMGYSTJT-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H11NO2.C2H7N/c1-6(2,3)4-5(7)8;1-3-2/h4H2,1-3H3;3H,1-2H3/p+1.
What are the key properties of dimethylazanium;2-(trimethylazaniumyl)acetate?
dimethylazanium;2-(trimethylazaniumyl)acetate has a molecular weight of 163.24 g/mol, XLogP of -2.75, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylazanium;2-(trimethylazaniumyl)acetate is sourced from PubChem (CID 22558275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).