C10H23NO6 — CID 19431176
2,2-bis(hydroxymethyl)propane-1,3-diol;2-(trimethylazaniumyl)acetate (PubChem CID 19431176) has the molecular formula C10H23NO6 and a molecular weight of 253.29 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;2-(trimethylazaniumyl)acetate.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;2-(trimethylazaniumyl)acetate |
|---|---|
| PubChem CID | 19431176 |
| Molecular Formula | C10H23NO6 |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;2-(trimethylazaniumyl)acetate |
| SMILES | C[N+](C)(C)CC(=O)[O-].OCC(CO)(CO)CO |
| InChI | InChI=1S/C5H11NO2.C5H12O4/c1-6(2,3)4-5(7)8;6-1-5(2-7,3-8)4-9/h4H2,1-3H3;6-9H,1-4H2 |
| InChIKey | HPILRNBCWQGNEF-UHFFFAOYSA-N |
| XLogP | -3.62 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|