About hexadecanoate;2-(trimethylazaniumyl)acetate
hexadecanoate;2-(trimethylazaniumyl)acetate (PubChem CID 22242455) has the molecular formula C21H42NO4-
and a molecular weight of 372.57 g/mol. Its IUPAC name is hexadecanoate;2-(trimethylazaniumyl)acetate.
Molecular Properties
| Compound Name | hexadecanoate;2-(trimethylazaniumyl)acetate |
| PubChem CID | 22242455 |
| Molecular Formula | C21H42NO4- |
| Molecular Weight | 372.57 g/mol |
| Exact Mass | 372.31 |
| IUPAC Name | hexadecanoate;2-(trimethylazaniumyl)acetate |
| SMILES | CCCCCCCCCCCCCCCC(=O)[O-].C[N+](C)(C)CC(=O)[O-] |
| InChI | InChI=1S/C16H32O2.C5H11NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-6(2,3)4-5(7)8/h2-15H2,1H3,(H,17,18);4H2,1-3H3/p-1 |
| InChIKey | NPSWTJNLDMOFHZ-UHFFFAOYSA-M |
| XLogP | 2.66 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.57 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze hexadecanoate;2-(trimethylazaniumyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecanoate;2-(trimethylazaniumyl)acetate?
The IUPAC name of hexadecanoate;2-(trimethylazaniumyl)acetate (CID 22242455) is hexadecanoate;2-(trimethylazaniumyl)acetate.
What is the SMILES notation for hexadecanoate;2-(trimethylazaniumyl)acetate?
The canonical SMILES for hexadecanoate;2-(trimethylazaniumyl)acetate is CCCCCCCCCCCCCCCC(=O)[O-].C[N+](C)(C)CC(=O)[O-].
What is the InChIKey of hexadecanoate;2-(trimethylazaniumyl)acetate?
The InChIKey is NPSWTJNLDMOFHZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H32O2.C5H11NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-6(2,3)4-5(7)8/h2-15H2,1H3,(H,17,18);4H2,1-3H3/p-1.
What are the key properties of hexadecanoate;2-(trimethylazaniumyl)acetate?
hexadecanoate;2-(trimethylazaniumyl)acetate has a molecular weight of 372.57 g/mol, XLogP of 2.66, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecanoate;2-(trimethylazaniumyl)acetate is sourced from PubChem (CID 22242455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).