About hexadecanoate;tetramethylazanium
hexadecanoate;tetramethylazanium (PubChem CID 14251637) has the molecular formula C20H43NO2
and a molecular weight of 329.57 g/mol. Its IUPAC name is hexadecanoate;tetramethylazanium.
Molecular Properties
| Compound Name | hexadecanoate;tetramethylazanium |
| PubChem CID | 14251637 |
| Molecular Formula | C20H43NO2 |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 329.33 |
| IUPAC Name | hexadecanoate;tetramethylazanium |
| SMILES | CCCCCCCCCCCCCCCC(=O)[O-].C[N+](C)(C)C |
| InChI | InChI=1S/C16H32O2.C4H12N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-5(2,3)4/h2-15H2,1H3,(H,17,18);1-4H3/q;+1/p-1 |
| InChIKey | RSAVMHVHRMZJMM-UHFFFAOYSA-M |
| XLogP | 4.54 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze hexadecanoate;tetramethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecanoate;tetramethylazanium?
The IUPAC name of hexadecanoate;tetramethylazanium (CID 14251637) is hexadecanoate;tetramethylazanium.
What is the SMILES notation for hexadecanoate;tetramethylazanium?
The canonical SMILES for hexadecanoate;tetramethylazanium is CCCCCCCCCCCCCCCC(=O)[O-].C[N+](C)(C)C.
What is the InChIKey of hexadecanoate;tetramethylazanium?
The InChIKey is RSAVMHVHRMZJMM-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H32O2.C4H12N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-5(2,3)4/h2-15H2,1H3,(H,17,18);1-4H3/q;+1/p-1.
What are the key properties of hexadecanoate;tetramethylazanium?
hexadecanoate;tetramethylazanium has a molecular weight of 329.57 g/mol, XLogP of 4.54, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecanoate;tetramethylazanium is sourced from PubChem (CID 14251637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).