About octadecanoate
octadecanoate (PubChem CID 3033836) has the molecular formula C18H35O2-
and a molecular weight of 283.48 g/mol. Its IUPAC name is octadecanoate.
Molecular Properties
| Compound Name | octadecanoate |
| PubChem CID | 3033836 |
| Molecular Formula | C18H35O2- |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 283.26 |
| IUPAC Name | octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20)/p-1 |
| InChIKey | QIQXTHQIDYTFRH-UHFFFAOYSA-M |
| XLogP | 5.00 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecanoate?
The IUPAC name of octadecanoate (CID 3033836) is octadecanoate.
What is the SMILES notation for octadecanoate?
The canonical SMILES for octadecanoate is CCCCCCCCCCCCCCCCCC(=O)[O-].
What is the InChIKey of octadecanoate?
The InChIKey is QIQXTHQIDYTFRH-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20)/p-1.
What are the key properties of octadecanoate?
octadecanoate has a molecular weight of 283.48 g/mol, XLogP of 5.00, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octadecanoate is sourced from PubChem (CID 3033836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).