About decanoate;lanthanum(3+)
decanoate;lanthanum(3+) (PubChem CID 21139452) has the molecular formula C10H19LaO2+2
and a molecular weight of 310.17 g/mol. Its IUPAC name is decanoate;lanthanum(3+).
Molecular Properties
| Compound Name | decanoate;lanthanum(3+) |
| PubChem CID | 21139452 |
| Molecular Formula | C10H19LaO2+2 |
| Molecular Weight | 310.17 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | decanoate;lanthanum(3+) |
| SMILES | CCCCCCCCCC(=O)[O-].[La+3] |
| InChI | InChI=1S/C10H20O2.La/c1-2-3-4-5-6-7-8-9-10(11)12;/h2-9H2,1H3,(H,11,12);/q;+3/p-1 |
| InChIKey | VOEVDNGUAORBPA-UHFFFAOYSA-M |
| XLogP | 1.88 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.17 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decanoate;lanthanum(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decanoate;lanthanum(3+)?
The IUPAC name of decanoate;lanthanum(3+) (CID 21139452) is decanoate;lanthanum(3+).
What is the SMILES notation for decanoate;lanthanum(3+)?
The canonical SMILES for decanoate;lanthanum(3+) is CCCCCCCCCC(=O)[O-].[La+3].
What is the InChIKey of decanoate;lanthanum(3+)?
The InChIKey is VOEVDNGUAORBPA-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H20O2.La/c1-2-3-4-5-6-7-8-9-10(11)12;/h2-9H2,1H3,(H,11,12);/q;+3/p-1.
What are the key properties of decanoate;lanthanum(3+)?
decanoate;lanthanum(3+) has a molecular weight of 310.17 g/mol, XLogP of 1.88, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decanoate;lanthanum(3+) is sourced from PubChem (CID 21139452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).