About magnesium;docosanoate;octadecanoate
magnesium;docosanoate;octadecanoate (PubChem CID 158868243) has the molecular formula C40H78MgO4
and a molecular weight of 647.37 g/mol. Its IUPAC name is magnesium;docosanoate;octadecanoate.
Molecular Properties
| Compound Name | magnesium;docosanoate;octadecanoate |
| PubChem CID | 158868243 |
| Molecular Formula | C40H78MgO4 |
| Molecular Weight | 647.37 g/mol |
| Exact Mass | 646.58 |
| IUPAC Name | magnesium;docosanoate;octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCCCCCCCCCCCC(=O)[O-].[Mg+2] |
| InChI | InChI=1S/C22H44O2.C18H36O2.Mg/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2-21H2,1H3,(H,23,24);2-17H2,1H3,(H,19,20);/q;;+2/p-2 |
| InChIKey | AQKRHLQBIBFPGQ-UHFFFAOYSA-L |
| XLogP | 11.18 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 647.37 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze magnesium;docosanoate;octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;docosanoate;octadecanoate?
The IUPAC name of magnesium;docosanoate;octadecanoate (CID 158868243) is magnesium;docosanoate;octadecanoate.
What is the SMILES notation for magnesium;docosanoate;octadecanoate?
The canonical SMILES for magnesium;docosanoate;octadecanoate is CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCCCCCCCCCCCC(=O)[O-].[Mg+2].
What is the InChIKey of magnesium;docosanoate;octadecanoate?
The InChIKey is AQKRHLQBIBFPGQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C22H44O2.C18H36O2.Mg/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2-21H2,1H3,(H,23,24);2-17H2,1H3,(H,19,20);/q;;+2/p-2.
What are the key properties of magnesium;docosanoate;octadecanoate?
magnesium;docosanoate;octadecanoate has a molecular weight of 647.37 g/mol, XLogP of 11.18, 36 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;docosanoate;octadecanoate is sourced from PubChem (CID 158868243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).