About magnesium;octanoate;chloride
magnesium;octanoate;chloride (PubChem CID 172837629) has the molecular formula C8H15ClMgO2
and a molecular weight of 202.96 g/mol. Its IUPAC name is magnesium;octanoate;chloride.
Molecular Properties
| Compound Name | magnesium;octanoate;chloride |
| PubChem CID | 172837629 |
| Molecular Formula | C8H15ClMgO2 |
| Molecular Weight | 202.96 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | magnesium;octanoate;chloride |
| SMILES | CCCCCCCC(=O)[O-].[Cl-].[Mg+2] |
| InChI | InChI=1S/C8H16O2.ClH.Mg/c1-2-3-4-5-6-7-8(9)10;;/h2-7H2,1H3,(H,9,10);1H;/q;;+2/p-2 |
| InChIKey | WJEZHBRWNWTEMW-UHFFFAOYSA-L |
| XLogP | -2.28 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.96 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze magnesium;octanoate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;octanoate;chloride?
The IUPAC name of magnesium;octanoate;chloride (CID 172837629) is magnesium;octanoate;chloride.
What is the SMILES notation for magnesium;octanoate;chloride?
The canonical SMILES for magnesium;octanoate;chloride is CCCCCCCC(=O)[O-].[Cl-].[Mg+2].
What is the InChIKey of magnesium;octanoate;chloride?
The InChIKey is WJEZHBRWNWTEMW-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H16O2.ClH.Mg/c1-2-3-4-5-6-7-8(9)10;;/h2-7H2,1H3,(H,9,10);1H;/q;;+2/p-2.
What are the key properties of magnesium;octanoate;chloride?
magnesium;octanoate;chloride has a molecular weight of 202.96 g/mol, XLogP of -2.28, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;octanoate;chloride is sourced from PubChem (CID 172837629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).