About dicalcium;octadecanoate;chloride
dicalcium;octadecanoate;chloride (PubChem CID 161460201) has the molecular formula C18H35Ca2ClO2+2
and a molecular weight of 399.09 g/mol. Its IUPAC name is dicalcium;octadecanoate;chloride.
Molecular Properties
| Compound Name | dicalcium;octadecanoate;chloride |
| PubChem CID | 161460201 |
| Molecular Formula | C18H35Ca2ClO2+2 |
| Molecular Weight | 399.09 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | dicalcium;octadecanoate;chloride |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].[Ca+2].[Ca+2].[Cl-] |
| InChI | InChI=1S/C18H36O2.2Ca.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;;;/h2-17H2,1H3,(H,19,20);;;1H/q;2*+2;/p-2 |
| InChIKey | WBRSOYQLUNOKPZ-UHFFFAOYSA-L |
| XLogP | 1.24 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.09 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dicalcium;octadecanoate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicalcium;octadecanoate;chloride?
The IUPAC name of dicalcium;octadecanoate;chloride (CID 161460201) is dicalcium;octadecanoate;chloride.
What is the SMILES notation for dicalcium;octadecanoate;chloride?
The canonical SMILES for dicalcium;octadecanoate;chloride is CCCCCCCCCCCCCCCCCC(=O)[O-].[Ca+2].[Ca+2].[Cl-].
What is the InChIKey of dicalcium;octadecanoate;chloride?
The InChIKey is WBRSOYQLUNOKPZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H36O2.2Ca.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;;;/h2-17H2,1H3,(H,19,20);;;1H/q;2*+2;/p-2.
What are the key properties of dicalcium;octadecanoate;chloride?
dicalcium;octadecanoate;chloride has a molecular weight of 399.09 g/mol, XLogP of 1.24, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dicalcium;octadecanoate;chloride is sourced from PubChem (CID 161460201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).