About cesium nonanoate
cesium nonanoate (PubChem CID 140771880) has the molecular formula C9H17CsO2
and a molecular weight of 290.14 g/mol. Its IUPAC name is cesium nonanoate.
Molecular Properties
| Compound Name | cesium nonanoate |
| PubChem CID | 140771880 |
| Molecular Formula | C9H17CsO2 |
| Molecular Weight | 290.14 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | cesium nonanoate |
| SMILES | CCCCCCCCC(=O)[O-].[Cs+] |
| InChI | InChI=1S/C9H18O2.Cs/c1-2-3-4-5-6-7-8-9(10)11;/h2-8H2,1H3,(H,10,11);/q;+1/p-1 |
| InChIKey | HAXNKKSVZGDYPL-UHFFFAOYSA-M |
| XLogP | -1.51 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.14 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cesium nonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium nonanoate?
The IUPAC name of cesium nonanoate (CID 140771880) is cesium nonanoate.
What is the SMILES notation for cesium nonanoate?
The canonical SMILES for cesium nonanoate is CCCCCCCCC(=O)[O-].[Cs+].
What is the InChIKey of cesium nonanoate?
The InChIKey is HAXNKKSVZGDYPL-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H18O2.Cs/c1-2-3-4-5-6-7-8-9(10)11;/h2-8H2,1H3,(H,10,11);/q;+1/p-1.
What are the key properties of cesium nonanoate?
cesium nonanoate has a molecular weight of 290.14 g/mol, XLogP of -1.51, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cesium nonanoate is sourced from PubChem (CID 140771880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).