About cesium tetradecanoate
cesium tetradecanoate (PubChem CID 23690793) has the molecular formula C14H27CsO2
and a molecular weight of 360.27 g/mol. Its IUPAC name is cesium tetradecanoate.
Molecular Properties
| Compound Name | cesium tetradecanoate |
| PubChem CID | 23690793 |
| Molecular Formula | C14H27CsO2 |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | cesium tetradecanoate |
| SMILES | CCCCCCCCCCCCCC(=O)[O-].[Cs+] |
| InChI | InChI=1S/C14H28O2.Cs/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;/h2-13H2,1H3,(H,15,16);/q;+1/p-1 |
| InChIKey | GUGOWSVMOVIQLV-UHFFFAOYSA-M |
| XLogP | 0.44 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cesium tetradecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium tetradecanoate?
The IUPAC name of cesium tetradecanoate (CID 23690793) is cesium tetradecanoate.
What is the SMILES notation for cesium tetradecanoate?
The canonical SMILES for cesium tetradecanoate is CCCCCCCCCCCCCC(=O)[O-].[Cs+].
What is the InChIKey of cesium tetradecanoate?
The InChIKey is GUGOWSVMOVIQLV-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H28O2.Cs/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;/h2-13H2,1H3,(H,15,16);/q;+1/p-1.
What are the key properties of cesium tetradecanoate?
cesium tetradecanoate has a molecular weight of 360.27 g/mol, XLogP of 0.44, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cesium tetradecanoate is sourced from PubChem (CID 23690793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).