About carboxymethyl(trimethyl)azanium;hexadecanoate
carboxymethyl(trimethyl)azanium;hexadecanoate (PubChem CID 127262286) has the molecular formula C21H43NO4
and a molecular weight of 373.58 g/mol. Its IUPAC name is carboxymethyl(trimethyl)azanium;hexadecanoate.
Molecular Properties
| Compound Name | carboxymethyl(trimethyl)azanium;hexadecanoate |
| PubChem CID | 127262286 |
| Molecular Formula | C21H43NO4 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.32 |
| IUPAC Name | carboxymethyl(trimethyl)azanium;hexadecanoate |
| SMILES | CCCCCCCCCCCCCCCC(=O)[O-].C[N+](C)(C)CC(=O)O |
| InChI | InChI=1S/C16H32O2.C5H11NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-6(2,3)4-5(7)8/h2-15H2,1H3,(H,17,18);4H2,1-3H3 |
| InChIKey | NPSWTJNLDMOFHZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze carboxymethyl(trimethyl)azanium;hexadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carboxymethyl(trimethyl)azanium;hexadecanoate?
The IUPAC name of carboxymethyl(trimethyl)azanium;hexadecanoate (CID 127262286) is carboxymethyl(trimethyl)azanium;hexadecanoate.
What is the SMILES notation for carboxymethyl(trimethyl)azanium;hexadecanoate?
The canonical SMILES for carboxymethyl(trimethyl)azanium;hexadecanoate is CCCCCCCCCCCCCCCC(=O)[O-].C[N+](C)(C)CC(=O)O.
What is the InChIKey of carboxymethyl(trimethyl)azanium;hexadecanoate?
The InChIKey is NPSWTJNLDMOFHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2.C5H11NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-6(2,3)4-5(7)8/h2-15H2,1H3,(H,17,18);4H2,1-3H3.
What are the key properties of carboxymethyl(trimethyl)azanium;hexadecanoate?
carboxymethyl(trimethyl)azanium;hexadecanoate has a molecular weight of 373.58 g/mol, XLogP of 3.99, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carboxymethyl(trimethyl)azanium;hexadecanoate is sourced from PubChem (CID 127262286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).