About sodium;docosanoic acid;octadecanoate
sodium;docosanoic acid;octadecanoate (PubChem CID 174660155) has the molecular formula C40H79NaO4
and a molecular weight of 647.06 g/mol. Its IUPAC name is sodium;docosanoic acid;octadecanoate.
Molecular Properties
| Compound Name | sodium;docosanoic acid;octadecanoate |
| PubChem CID | 174660155 |
| Molecular Formula | C40H79NaO4 |
| Molecular Weight | 647.06 g/mol |
| Exact Mass | 646.59 |
| IUPAC Name | sodium;docosanoic acid;octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCCCCCCCCCCCC(=O)O.[Na+] |
| InChI | InChI=1S/C22H44O2.C18H36O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2-21H2,1H3,(H,23,24);2-17H2,1H3,(H,19,20);/q;;+1/p-1 |
| InChIKey | UITRJRAYPINVHT-UHFFFAOYSA-M |
| XLogP | 9.89 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 647.06 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium;docosanoic acid;octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;docosanoic acid;octadecanoate?
The IUPAC name of sodium;docosanoic acid;octadecanoate (CID 174660155) is sodium;docosanoic acid;octadecanoate.
What is the SMILES notation for sodium;docosanoic acid;octadecanoate?
The canonical SMILES for sodium;docosanoic acid;octadecanoate is CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCCCCCCCCCCCC(=O)O.[Na+].
What is the InChIKey of sodium;docosanoic acid;octadecanoate?
The InChIKey is UITRJRAYPINVHT-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H44O2.C18H36O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2-21H2,1H3,(H,23,24);2-17H2,1H3,(H,19,20);/q;;+1/p-1.
What are the key properties of sodium;docosanoic acid;octadecanoate?
sodium;docosanoic acid;octadecanoate has a molecular weight of 647.06 g/mol, XLogP of 9.89, 36 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;docosanoic acid;octadecanoate is sourced from PubChem (CID 174660155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).