About potassium;hexanoate;hexanoic acid
potassium;hexanoate;hexanoic acid (PubChem CID 175726310) has the molecular formula C12H23KO4
and a molecular weight of 270.41 g/mol. Its IUPAC name is potassium;hexanoate;hexanoic acid.
Molecular Properties
| Compound Name | potassium;hexanoate;hexanoic acid |
| PubChem CID | 175726310 |
| Molecular Formula | C12H23KO4 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | potassium;hexanoate;hexanoic acid |
| SMILES | CCCCCC(=O)O.CCCCCC(=O)[O-].[K+] |
| InChI | InChI=1S/2C6H12O2.K/c2*1-2-3-4-5-6(7)8;/h2*2-5H2,1H3,(H,7,8);/q;;+1/p-1 |
| InChIKey | RSRIZVYUVKVRJY-UHFFFAOYSA-M |
| XLogP | -1.03 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze potassium;hexanoate;hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hexanoate;hexanoic acid?
The IUPAC name of potassium;hexanoate;hexanoic acid (CID 175726310) is potassium;hexanoate;hexanoic acid.
What is the SMILES notation for potassium;hexanoate;hexanoic acid?
The canonical SMILES for potassium;hexanoate;hexanoic acid is CCCCCC(=O)O.CCCCCC(=O)[O-].[K+].
What is the InChIKey of potassium;hexanoate;hexanoic acid?
The InChIKey is RSRIZVYUVKVRJY-UHFFFAOYSA-M. The full InChI is InChI=1S/2C6H12O2.K/c2*1-2-3-4-5-6(7)8;/h2*2-5H2,1H3,(H,7,8);/q;;+1/p-1.
What are the key properties of potassium;hexanoate;hexanoic acid?
potassium;hexanoate;hexanoic acid has a molecular weight of 270.41 g/mol, XLogP of -1.03, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hexanoate;hexanoic acid is sourced from PubChem (CID 175726310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).