About hexanoate;trimethyl(nonyl)azanium
hexanoate;trimethyl(nonyl)azanium (PubChem CID 139992279) has the molecular formula C18H39NO2
and a molecular weight of 301.52 g/mol. Its IUPAC name is hexanoate;trimethyl(nonyl)azanium.
Molecular Properties
| Compound Name | hexanoate;trimethyl(nonyl)azanium |
| PubChem CID | 139992279 |
| Molecular Formula | C18H39NO2 |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.30 |
| IUPAC Name | hexanoate;trimethyl(nonyl)azanium |
| SMILES | CCCCCC(=O)[O-].CCCCCCCCC[N+](C)(C)C |
| InChI | InChI=1S/C12H28N.C6H12O2/c1-5-6-7-8-9-10-11-12-13(2,3)4;1-2-3-4-5-6(7)8/h5-12H2,1-4H3;2-5H2,1H3,(H,7,8)/q+1;/p-1 |
| InChIKey | HIWGDTOXWWQTPW-UHFFFAOYSA-M |
| XLogP | 3.76 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze hexanoate;trimethyl(nonyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanoate;trimethyl(nonyl)azanium?
The IUPAC name of hexanoate;trimethyl(nonyl)azanium (CID 139992279) is hexanoate;trimethyl(nonyl)azanium.
What is the SMILES notation for hexanoate;trimethyl(nonyl)azanium?
The canonical SMILES for hexanoate;trimethyl(nonyl)azanium is CCCCCC(=O)[O-].CCCCCCCCC[N+](C)(C)C.
What is the InChIKey of hexanoate;trimethyl(nonyl)azanium?
The InChIKey is HIWGDTOXWWQTPW-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H28N.C6H12O2/c1-5-6-7-8-9-10-11-12-13(2,3)4;1-2-3-4-5-6(7)8/h5-12H2,1-4H3;2-5H2,1H3,(H,7,8)/q+1;/p-1.
What are the key properties of hexanoate;trimethyl(nonyl)azanium?
hexanoate;trimethyl(nonyl)azanium has a molecular weight of 301.52 g/mol, XLogP of 3.76, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexanoate;trimethyl(nonyl)azanium is sourced from PubChem (CID 139992279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).