About aluminum octanoate
aluminum octanoate (PubChem CID 23176142) has the molecular formula C8H15AlO2+2
and a molecular weight of 170.19 g/mol. Its IUPAC name is aluminum octanoate.
Molecular Properties
| Compound Name | aluminum octanoate |
| PubChem CID | 23176142 |
| Molecular Formula | C8H15AlO2+2 |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | aluminum octanoate |
| SMILES | CCCCCCCC(=O)[O-].[Al+3] |
| InChI | InChI=1S/C8H16O2.Al/c1-2-3-4-5-6-7-8(9)10;/h2-7H2,1H3,(H,9,10);/q;+3/p-1 |
| InChIKey | BIAMYKBXBDVYJI-UHFFFAOYSA-M |
| XLogP | 0.72 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.19 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze aluminum octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum octanoate?
The IUPAC name of aluminum octanoate (CID 23176142) is aluminum octanoate.
What is the SMILES notation for aluminum octanoate?
The canonical SMILES for aluminum octanoate is CCCCCCCC(=O)[O-].[Al+3].
What is the InChIKey of aluminum octanoate?
The InChIKey is BIAMYKBXBDVYJI-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16O2.Al/c1-2-3-4-5-6-7-8(9)10;/h2-7H2,1H3,(H,9,10);/q;+3/p-1.
What are the key properties of aluminum octanoate?
aluminum octanoate has a molecular weight of 170.19 g/mol, XLogP of 0.72, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum octanoate is sourced from PubChem (CID 23176142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).