About formonitrile;2-(trimethylazaniumyl)acetate
formonitrile;2-(trimethylazaniumyl)acetate (PubChem CID 173415938) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is formonitrile;2-(trimethylazaniumyl)acetate.
Molecular Properties
| Compound Name | formonitrile;2-(trimethylazaniumyl)acetate |
| PubChem CID | 173415938 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | formonitrile;2-(trimethylazaniumyl)acetate |
| SMILES | C#N.C[N+](C)(C)CC(=O)[O-] |
| InChI | InChI=1S/C5H11NO2.CHN/c1-6(2,3)4-5(7)8;1-2/h4H2,1-3H3;1H |
| InChIKey | GCSJYJHZCDRRIJ-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 63.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze formonitrile;2-(trimethylazaniumyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formonitrile;2-(trimethylazaniumyl)acetate?
The IUPAC name of formonitrile;2-(trimethylazaniumyl)acetate (CID 173415938) is formonitrile;2-(trimethylazaniumyl)acetate.
What is the SMILES notation for formonitrile;2-(trimethylazaniumyl)acetate?
The canonical SMILES for formonitrile;2-(trimethylazaniumyl)acetate is C#N.C[N+](C)(C)CC(=O)[O-].
What is the InChIKey of formonitrile;2-(trimethylazaniumyl)acetate?
The InChIKey is GCSJYJHZCDRRIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.CHN/c1-6(2,3)4-5(7)8;1-2/h4H2,1-3H3;1H.
What are the key properties of formonitrile;2-(trimethylazaniumyl)acetate?
formonitrile;2-(trimethylazaniumyl)acetate has a molecular weight of 144.17 g/mol, XLogP of -1.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formonitrile;2-(trimethylazaniumyl)acetate is sourced from PubChem (CID 173415938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).