About 2-(dimethylamino)propanoic acid;dodecanamide;propyl acetate
2-(dimethylamino)propanoic acid;dodecanamide;propyl acetate (PubChem CID 157231037) has the molecular formula C22H46N2O5
and a molecular weight of 418.62 g/mol. Its IUPAC name is 2-(dimethylamino)propanoic acid;dodecanamide;propyl acetate.
Molecular Properties
| Compound Name | 2-(dimethylamino)propanoic acid;dodecanamide;propyl acetate |
| PubChem CID | 157231037 |
| Molecular Formula | C22H46N2O5 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.34 |
| IUPAC Name | 2-(dimethylamino)propanoic acid;dodecanamide;propyl acetate |
| SMILES | CC(C(=O)O)N(C)C.CCCCCCCCCCCC(N)=O.CCCOC(C)=O |
| InChI | InChI=1S/C12H25NO.C5H11NO2.C5H10O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-4(5(7)8)6(2)3;1-3-4-7-5(2)6/h2-11H2,1H3,(H2,13,14);4H,1-3H3,(H,7,8);3-4H2,1-2H3 |
| InChIKey | AUCIGKNGAUWWDT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)propanoic acid;dodecanamide;propyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)propanoic acid;dodecanamide;propyl acetate?
The IUPAC name of 2-(dimethylamino)propanoic acid;dodecanamide;propyl acetate (CID 157231037) is 2-(dimethylamino)propanoic acid;dodecanamide;propyl acetate.
What is the SMILES notation for 2-(dimethylamino)propanoic acid;dodecanamide;propyl acetate?
The canonical SMILES for 2-(dimethylamino)propanoic acid;dodecanamide;propyl acetate is CC(C(=O)O)N(C)C.CCCCCCCCCCCC(N)=O.CCCOC(C)=O.
What is the InChIKey of 2-(dimethylamino)propanoic acid;dodecanamide;propyl acetate?
The InChIKey is AUCIGKNGAUWWDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO.C5H11NO2.C5H10O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-4(5(7)8)6(2)3;1-3-4-7-5(2)6/h2-11H2,1H3,(H2,13,14);4H,1-3H3,(H,7,8);3-4H2,1-2H3.
What are the key properties of 2-(dimethylamino)propanoic acid;dodecanamide;propyl acetate?
2-(dimethylamino)propanoic acid;dodecanamide;propyl acetate has a molecular weight of 418.62 g/mol, XLogP of 4.37, 14 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)propanoic acid;dodecanamide;propyl acetate is sourced from PubChem (CID 157231037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).