About sodium;octanamide;propanoate
sodium;octanamide;propanoate (PubChem CID 158225803) has the molecular formula C11H22NNaO3
and a molecular weight of 239.29 g/mol. Its IUPAC name is sodium;octanamide;propanoate.
Molecular Properties
| Compound Name | sodium;octanamide;propanoate |
| PubChem CID | 158225803 |
| Molecular Formula | C11H22NNaO3 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | sodium;octanamide;propanoate |
| SMILES | CCC(=O)[O-].CCCCCCCC(N)=O.[Na+] |
| InChI | InChI=1S/C8H17NO.C3H6O2.Na/c1-2-3-4-5-6-7-8(9)10;1-2-3(4)5;/h2-7H2,1H3,(H2,9,10);2H2,1H3,(H,4,5);/q;;+1/p-1 |
| InChIKey | HJRMDFBSPTWKAW-UHFFFAOYSA-M |
| XLogP | -2.02 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium;octanamide;propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;octanamide;propanoate?
The IUPAC name of sodium;octanamide;propanoate (CID 158225803) is sodium;octanamide;propanoate.
What is the SMILES notation for sodium;octanamide;propanoate?
The canonical SMILES for sodium;octanamide;propanoate is CCC(=O)[O-].CCCCCCCC(N)=O.[Na+].
What is the InChIKey of sodium;octanamide;propanoate?
The InChIKey is HJRMDFBSPTWKAW-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H17NO.C3H6O2.Na/c1-2-3-4-5-6-7-8(9)10;1-2-3(4)5;/h2-7H2,1H3,(H2,9,10);2H2,1H3,(H,4,5);/q;;+1/p-1.
What are the key properties of sodium;octanamide;propanoate?
sodium;octanamide;propanoate has a molecular weight of 239.29 g/mol, XLogP of -2.02, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;octanamide;propanoate is sourced from PubChem (CID 158225803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).