About sodium heptadecanoate
sodium heptadecanoate (PubChem CID 23663632) has the molecular formula C17H33NaO2
and a molecular weight of 292.44 g/mol. Its IUPAC name is sodium heptadecanoate.
Molecular Properties
| Compound Name | sodium heptadecanoate |
| PubChem CID | 23663632 |
| Molecular Formula | C17H33NaO2 |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | sodium heptadecanoate |
| SMILES | CCCCCCCCCCCCCCCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C17H34O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19;/h2-16H2,1H3,(H,18,19);/q;+1/p-1 |
| InChIKey | OVYNXDWUWZJFBZ-UHFFFAOYSA-M |
| XLogP | 1.61 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium heptadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium heptadecanoate?
The IUPAC name of sodium heptadecanoate (CID 23663632) is sodium heptadecanoate.
What is the SMILES notation for sodium heptadecanoate?
The canonical SMILES for sodium heptadecanoate is CCCCCCCCCCCCCCCCC(=O)[O-].[Na+].
What is the InChIKey of sodium heptadecanoate?
The InChIKey is OVYNXDWUWZJFBZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H34O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19;/h2-16H2,1H3,(H,18,19);/q;+1/p-1.
What are the key properties of sodium heptadecanoate?
sodium heptadecanoate has a molecular weight of 292.44 g/mol, XLogP of 1.61, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium heptadecanoate is sourced from PubChem (CID 23663632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).