About disodium;hexadecanoate;hydride
disodium;hexadecanoate;hydride (PubChem CID 175497394) has the molecular formula C16H32Na2O2
and a molecular weight of 302.41 g/mol. Its IUPAC name is disodium;hexadecanoate;hydride.
Molecular Properties
| Compound Name | disodium;hexadecanoate;hydride |
| PubChem CID | 175497394 |
| Molecular Formula | C16H32Na2O2 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | disodium;hexadecanoate;hydride |
| SMILES | CCCCCCCCCCCCCCCC(=O)[O-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C16H32O2.2Na.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;;;/h2-15H2,1H3,(H,17,18);;;/q;2*+1;-1/p-1 |
| InChIKey | RATYJBQZWWDFPK-UHFFFAOYSA-M |
| XLogP | -1.66 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze disodium;hexadecanoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;hexadecanoate;hydride?
The IUPAC name of disodium;hexadecanoate;hydride (CID 175497394) is disodium;hexadecanoate;hydride.
What is the SMILES notation for disodium;hexadecanoate;hydride?
The canonical SMILES for disodium;hexadecanoate;hydride is CCCCCCCCCCCCCCCC(=O)[O-].[H-].[Na+].[Na+].
What is the InChIKey of disodium;hexadecanoate;hydride?
The InChIKey is RATYJBQZWWDFPK-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H32O2.2Na.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;;;/h2-15H2,1H3,(H,17,18);;;/q;2*+1;-1/p-1.
What are the key properties of disodium;hexadecanoate;hydride?
disodium;hexadecanoate;hydride has a molecular weight of 302.41 g/mol, XLogP of -1.66, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;hexadecanoate;hydride is sourced from PubChem (CID 175497394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).