About sodium;azane;dodecanoate
sodium;azane;dodecanoate (PubChem CID 23690680) has the molecular formula C12H26NNaO2
and a molecular weight of 239.33 g/mol. Its IUPAC name is sodium;azane;dodecanoate.
Molecular Properties
| Compound Name | sodium;azane;dodecanoate |
| PubChem CID | 23690680 |
| Molecular Formula | C12H26NNaO2 |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | sodium;azane;dodecanoate |
| SMILES | CCCCCCCCCCCC(=O)[O-].N.[Na+] |
| InChI | InChI=1S/C12H24O2.H3N.Na/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;;/h2-11H2,1H3,(H,13,14);1H3;/q;;+1/p-1 |
| InChIKey | FJQPCDXSOHOENR-UHFFFAOYSA-M |
| XLogP | -0.18 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium;azane;dodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;azane;dodecanoate?
The IUPAC name of sodium;azane;dodecanoate (CID 23690680) is sodium;azane;dodecanoate.
What is the SMILES notation for sodium;azane;dodecanoate?
The canonical SMILES for sodium;azane;dodecanoate is CCCCCCCCCCCC(=O)[O-].N.[Na+].
What is the InChIKey of sodium;azane;dodecanoate?
The InChIKey is FJQPCDXSOHOENR-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H24O2.H3N.Na/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;;/h2-11H2,1H3,(H,13,14);1H3;/q;;+1/p-1.
What are the key properties of sodium;azane;dodecanoate?
sodium;azane;dodecanoate has a molecular weight of 239.33 g/mol, XLogP of -0.18, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;azane;dodecanoate is sourced from PubChem (CID 23690680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).