About sodium;carbane;octanoate
sodium;carbane;octanoate (PubChem CID 88711912) has the molecular formula C9H19NaO2
and a molecular weight of 184.23 g/mol. Its IUPAC name is sodium;carbane;octanoate.
Molecular Properties
| Compound Name | sodium;carbane;octanoate |
| PubChem CID | 88711912 |
| Molecular Formula | C9H19NaO2 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | sodium;carbane;octanoate |
| SMILES | CCCCCCCC(=O)[O-].[14CH4].[Na+] |
| InChI | InChI=1S/C8H16O2.CH4.Na/c1-2-3-4-5-6-7-8(9)10;;/h2-7H2,1H3,(H,9,10);1H4;/q;;+1/p-1/i;1+2; |
| InChIKey | SQJJHCCGIIKGRL-QCSIMTJTSA-M |
| XLogP | -1.26 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium;carbane;octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;carbane;octanoate?
The IUPAC name of sodium;carbane;octanoate (CID 88711912) is sodium;carbane;octanoate.
What is the SMILES notation for sodium;carbane;octanoate?
The canonical SMILES for sodium;carbane;octanoate is CCCCCCCC(=O)[O-].[14CH4].[Na+].
What is the InChIKey of sodium;carbane;octanoate?
The InChIKey is SQJJHCCGIIKGRL-QCSIMTJTSA-M. The full InChI is InChI=1S/C8H16O2.CH4.Na/c1-2-3-4-5-6-7-8(9)10;;/h2-7H2,1H3,(H,9,10);1H4;/q;;+1/p-1/i;1+2;.
What are the key properties of sodium;carbane;octanoate?
sodium;carbane;octanoate has a molecular weight of 184.23 g/mol, XLogP of -1.26, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;carbane;octanoate is sourced from PubChem (CID 88711912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).