About sodium pentadecanoate
sodium pentadecanoate (PubChem CID 23663638) has the molecular formula C15H29NaO2
and a molecular weight of 264.38 g/mol. Its IUPAC name is sodium pentadecanoate.
Molecular Properties
| Compound Name | sodium pentadecanoate |
| PubChem CID | 23663638 |
| Molecular Formula | C15H29NaO2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | sodium pentadecanoate |
| SMILES | CCCCCCCCCCCCCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C15H30O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17;/h2-14H2,1H3,(H,16,17);/q;+1/p-1 |
| InChIKey | DLJKLUIGOGBWRW-UHFFFAOYSA-M |
| XLogP | 0.83 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium pentadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium pentadecanoate?
The IUPAC name of sodium pentadecanoate (CID 23663638) is sodium pentadecanoate.
What is the SMILES notation for sodium pentadecanoate?
The canonical SMILES for sodium pentadecanoate is CCCCCCCCCCCCCCC(=O)[O-].[Na+].
What is the InChIKey of sodium pentadecanoate?
The InChIKey is DLJKLUIGOGBWRW-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H30O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17;/h2-14H2,1H3,(H,16,17);/q;+1/p-1.
What are the key properties of sodium pentadecanoate?
sodium pentadecanoate has a molecular weight of 264.38 g/mol, XLogP of 0.83, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium pentadecanoate is sourced from PubChem (CID 23663638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).