About trisodium;octadecanoate;carbonate
trisodium;octadecanoate;carbonate (PubChem CID 162024794) has the molecular formula C19H35Na3O5
and a molecular weight of 412.45 g/mol. Its IUPAC name is trisodium;octadecanoate;carbonate.
Molecular Properties
| Compound Name | trisodium;octadecanoate;carbonate |
| PubChem CID | 162024794 |
| Molecular Formula | C19H35Na3O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | trisodium;octadecanoate;carbonate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].O=C([O-])[O-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C18H36O2.CH2O3.3Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2-1(3)4;;;/h2-17H2,1H3,(H,19,20);(H2,2,3,4);;;/q;;3*+1/p-3 |
| InChIKey | YVFPOTYWLKYDNH-UHFFFAOYSA-K |
| XLogP | -6.44 |
| TPSA | 103.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | -6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze trisodium;octadecanoate;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;octadecanoate;carbonate?
The IUPAC name of trisodium;octadecanoate;carbonate (CID 162024794) is trisodium;octadecanoate;carbonate.
What is the SMILES notation for trisodium;octadecanoate;carbonate?
The canonical SMILES for trisodium;octadecanoate;carbonate is CCCCCCCCCCCCCCCCCC(=O)[O-].O=C([O-])[O-].[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;octadecanoate;carbonate?
The InChIKey is YVFPOTYWLKYDNH-UHFFFAOYSA-K. The full InChI is InChI=1S/C18H36O2.CH2O3.3Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2-1(3)4;;;/h2-17H2,1H3,(H,19,20);(H2,2,3,4);;;/q;;3*+1/p-3.
What are the key properties of trisodium;octadecanoate;carbonate?
trisodium;octadecanoate;carbonate has a molecular weight of 412.45 g/mol, XLogP of -6.44, 16 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;octadecanoate;carbonate is sourced from PubChem (CID 162024794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).