About ethanol;tridecanamide
ethanol;tridecanamide (PubChem CID 174935457) has the molecular formula C15H33NO2
and a molecular weight of 259.43 g/mol. Its IUPAC name is ethanol;tridecanamide.
Molecular Properties
| Compound Name | ethanol;tridecanamide |
| PubChem CID | 174935457 |
| Molecular Formula | C15H33NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | ethanol;tridecanamide |
| SMILES | CCCCCCCCCCCCC(N)=O.CCO |
| InChI | InChI=1S/C13H27NO.C2H6O/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15;1-2-3/h2-12H2,1H3,(H2,14,15);3H,2H2,1H3 |
| InChIKey | LMCSDFSKNAIDNE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethanol;tridecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;tridecanamide?
The IUPAC name of ethanol;tridecanamide (CID 174935457) is ethanol;tridecanamide.
What is the SMILES notation for ethanol;tridecanamide?
The canonical SMILES for ethanol;tridecanamide is CCCCCCCCCCCCC(N)=O.CCO.
What is the InChIKey of ethanol;tridecanamide?
The InChIKey is LMCSDFSKNAIDNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO.C2H6O/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15;1-2-3/h2-12H2,1H3,(H2,14,15);3H,2H2,1H3.
What are the key properties of ethanol;tridecanamide?
ethanol;tridecanamide has a molecular weight of 259.43 g/mol, XLogP of 3.78, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;tridecanamide is sourced from PubChem (CID 174935457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).