About potassium;hexanamide;hydride
potassium;hexanamide;hydride (PubChem CID 173117462) has the molecular formula C6H14KNO
and a molecular weight of 155.28 g/mol. Its IUPAC name is potassium;hexanamide;hydride.
Molecular Properties
| Compound Name | potassium;hexanamide;hydride |
| PubChem CID | 173117462 |
| Molecular Formula | C6H14KNO |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | potassium;hexanamide;hydride |
| SMILES | CCCCCC(N)=O.[H-].[K+] |
| InChI | InChI=1S/C6H13NO.K.H/c1-2-3-4-5-6(7)8;;/h2-5H2,1H3,(H2,7,8);;/q;+1;-1 |
| InChIKey | RKGKWAFIFIDHEI-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze potassium;hexanamide;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hexanamide;hydride?
The IUPAC name of potassium;hexanamide;hydride (CID 173117462) is potassium;hexanamide;hydride.
What is the SMILES notation for potassium;hexanamide;hydride?
The canonical SMILES for potassium;hexanamide;hydride is CCCCCC(N)=O.[H-].[K+].
What is the InChIKey of potassium;hexanamide;hydride?
The InChIKey is RKGKWAFIFIDHEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.K.H/c1-2-3-4-5-6(7)8;;/h2-5H2,1H3,(H2,7,8);;/q;+1;-1.
What are the key properties of potassium;hexanamide;hydride?
potassium;hexanamide;hydride has a molecular weight of 155.28 g/mol, XLogP of -1.83, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hexanamide;hydride is sourced from PubChem (CID 173117462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).