About dodecanamide;N-methylmethanamine
dodecanamide;N-methylmethanamine (PubChem CID 159337435) has the molecular formula C14H32N2O
and a molecular weight of 244.42 g/mol. Its IUPAC name is dodecanamide;N-methylmethanamine.
Molecular Properties
| Compound Name | dodecanamide;N-methylmethanamine |
| PubChem CID | 159337435 |
| Molecular Formula | C14H32N2O |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.25 |
| IUPAC Name | dodecanamide;N-methylmethanamine |
| SMILES | CCCCCCCCCCCC(N)=O.CNC |
| InChI | InChI=1S/C12H25NO.C2H7N/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-3-2/h2-11H2,1H3,(H2,13,14);3H,1-2H3 |
| InChIKey | LFSKRSNISOMLOO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecanamide;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecanamide;N-methylmethanamine?
The IUPAC name of dodecanamide;N-methylmethanamine (CID 159337435) is dodecanamide;N-methylmethanamine.
What is the SMILES notation for dodecanamide;N-methylmethanamine?
The canonical SMILES for dodecanamide;N-methylmethanamine is CCCCCCCCCCCC(N)=O.CNC.
What is the InChIKey of dodecanamide;N-methylmethanamine?
The InChIKey is LFSKRSNISOMLOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO.C2H7N/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-3-2/h2-11H2,1H3,(H2,13,14);3H,1-2H3.
What are the key properties of dodecanamide;N-methylmethanamine?
dodecanamide;N-methylmethanamine has a molecular weight of 244.42 g/mol, XLogP of 3.23, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dodecanamide;N-methylmethanamine is sourced from PubChem (CID 159337435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).