About hexadecanamide;2-hydroxypropanoic acid;N-methylmethanamine
hexadecanamide;2-hydroxypropanoic acid;N-methylmethanamine (PubChem CID 174723566) has the molecular formula C21H46N2O4
and a molecular weight of 390.61 g/mol. Its IUPAC name is hexadecanamide;2-hydroxypropanoic acid;N-methylmethanamine.
Molecular Properties
| Compound Name | hexadecanamide;2-hydroxypropanoic acid;N-methylmethanamine |
| PubChem CID | 174723566 |
| Molecular Formula | C21H46N2O4 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.35 |
| IUPAC Name | hexadecanamide;2-hydroxypropanoic acid;N-methylmethanamine |
| SMILES | CC(O)C(=O)O.CCCCCCCCCCCCCCCC(N)=O.CNC |
| InChI | InChI=1S/C16H33NO.C3H6O3.C2H7N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-2(4)3(5)6;1-3-2/h2-15H2,1H3,(H2,17,18);2,4H,1H3,(H,5,6);3H,1-2H3 |
| InChIKey | SODVHDKHSBPVDN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexadecanamide;2-hydroxypropanoic acid;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecanamide;2-hydroxypropanoic acid;N-methylmethanamine?
The IUPAC name of hexadecanamide;2-hydroxypropanoic acid;N-methylmethanamine (CID 174723566) is hexadecanamide;2-hydroxypropanoic acid;N-methylmethanamine.
What is the SMILES notation for hexadecanamide;2-hydroxypropanoic acid;N-methylmethanamine?
The canonical SMILES for hexadecanamide;2-hydroxypropanoic acid;N-methylmethanamine is CC(O)C(=O)O.CCCCCCCCCCCCCCCC(N)=O.CNC.
What is the InChIKey of hexadecanamide;2-hydroxypropanoic acid;N-methylmethanamine?
The InChIKey is SODVHDKHSBPVDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO.C3H6O3.C2H7N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-2(4)3(5)6;1-3-2/h2-15H2,1H3,(H2,17,18);2,4H,1H3,(H,5,6);3H,1-2H3.
What are the key properties of hexadecanamide;2-hydroxypropanoic acid;N-methylmethanamine?
hexadecanamide;2-hydroxypropanoic acid;N-methylmethanamine has a molecular weight of 390.61 g/mol, XLogP of 4.24, 15 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecanamide;2-hydroxypropanoic acid;N-methylmethanamine is sourced from PubChem (CID 174723566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).