About octadecanamide;1-(propylamino)ethanol
octadecanamide;1-(propylamino)ethanol (PubChem CID 137369550) has the molecular formula C23H50N2O2
and a molecular weight of 386.67 g/mol. Its IUPAC name is octadecanamide;1-(propylamino)ethanol.
Molecular Properties
| Compound Name | octadecanamide;1-(propylamino)ethanol |
| PubChem CID | 137369550 |
| Molecular Formula | C23H50N2O2 |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 386.39 |
| IUPAC Name | octadecanamide;1-(propylamino)ethanol |
| SMILES | CCCCCCCCCCCCCCCCCC(N)=O.CCCNC(C)O |
| InChI | InChI=1S/C18H37NO.C5H13NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-4-6-5(2)7/h2-17H2,1H3,(H2,19,20);5-7H,3-4H2,1-2H3 |
| InChIKey | VOEVYJBERVWHPU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze octadecanamide;1-(propylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecanamide;1-(propylamino)ethanol?
The IUPAC name of octadecanamide;1-(propylamino)ethanol (CID 137369550) is octadecanamide;1-(propylamino)ethanol.
What is the SMILES notation for octadecanamide;1-(propylamino)ethanol?
The canonical SMILES for octadecanamide;1-(propylamino)ethanol is CCCCCCCCCCCCCCCCCC(N)=O.CCCNC(C)O.
What is the InChIKey of octadecanamide;1-(propylamino)ethanol?
The InChIKey is VOEVYJBERVWHPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO.C5H13NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-4-6-5(2)7/h2-17H2,1H3,(H2,19,20);5-7H,3-4H2,1-2H3.
What are the key properties of octadecanamide;1-(propylamino)ethanol?
octadecanamide;1-(propylamino)ethanol has a molecular weight of 386.67 g/mol, XLogP of 6.06, 19 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octadecanamide;1-(propylamino)ethanol is sourced from PubChem (CID 137369550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).