About octadecanamide;bis(propan-2-ol)
octadecanamide;bis(propan-2-ol) (PubChem CID 90014672) has the molecular formula C24H53NO3
and a molecular weight of 403.69 g/mol. Its IUPAC name is octadecanamide;bis(propan-2-ol).
Molecular Properties
| Compound Name | octadecanamide;bis(propan-2-ol) |
| PubChem CID | 90014672 |
| Molecular Formula | C24H53NO3 |
| Molecular Weight | 403.69 g/mol |
| Exact Mass | 403.40 |
| IUPAC Name | octadecanamide;bis(propan-2-ol) |
| SMILES | CC(C)O.CC(C)O.CCCCCCCCCCCCCCCCCC(N)=O |
| InChI | InChI=1S/C18H37NO.2C3H8O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2*1-3(2)4/h2-17H2,1H3,(H2,19,20);2*3-4H,1-2H3 |
| InChIKey | FISKNIGAEBBANT-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.69 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octadecanamide;bis(propan-2-ol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecanamide;bis(propan-2-ol)?
The IUPAC name of octadecanamide;bis(propan-2-ol) (CID 90014672) is octadecanamide;bis(propan-2-ol).
What is the SMILES notation for octadecanamide;bis(propan-2-ol)?
The canonical SMILES for octadecanamide;bis(propan-2-ol) is CC(C)O.CC(C)O.CCCCCCCCCCCCCCCCCC(N)=O.
What is the InChIKey of octadecanamide;bis(propan-2-ol)?
The InChIKey is FISKNIGAEBBANT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO.2C3H8O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2*1-3(2)4/h2-17H2,1H3,(H2,19,20);2*3-4H,1-2H3.
What are the key properties of octadecanamide;bis(propan-2-ol)?
octadecanamide;bis(propan-2-ol) has a molecular weight of 403.69 g/mol, XLogP of 6.51, 16 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octadecanamide;bis(propan-2-ol) is sourced from PubChem (CID 90014672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).