About dodecanamide;N-propylhydroxylamine
dodecanamide;N-propylhydroxylamine (PubChem CID 175694166) has the molecular formula C15H34N2O2
and a molecular weight of 274.45 g/mol. Its IUPAC name is dodecanamide;N-propylhydroxylamine.
Molecular Properties
| Compound Name | dodecanamide;N-propylhydroxylamine |
| PubChem CID | 175694166 |
| Molecular Formula | C15H34N2O2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.26 |
| IUPAC Name | dodecanamide;N-propylhydroxylamine |
| SMILES | CCCCCCCCCCCC(N)=O.CCCNO |
| InChI | InChI=1S/C12H25NO.C3H9NO/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-2-3-4-5/h2-11H2,1H3,(H2,13,14);4-5H,2-3H2,1H3 |
| InChIKey | AYQRAVRWEPUOFL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dodecanamide;N-propylhydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecanamide;N-propylhydroxylamine?
The IUPAC name of dodecanamide;N-propylhydroxylamine (CID 175694166) is dodecanamide;N-propylhydroxylamine.
What is the SMILES notation for dodecanamide;N-propylhydroxylamine?
The canonical SMILES for dodecanamide;N-propylhydroxylamine is CCCCCCCCCCCC(N)=O.CCCNO.
What is the InChIKey of dodecanamide;N-propylhydroxylamine?
The InChIKey is AYQRAVRWEPUOFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO.C3H9NO/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-2-3-4-5/h2-11H2,1H3,(H2,13,14);4-5H,2-3H2,1H3.
What are the key properties of dodecanamide;N-propylhydroxylamine?
dodecanamide;N-propylhydroxylamine has a molecular weight of 274.45 g/mol, XLogP of 3.77, 12 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dodecanamide;N-propylhydroxylamine is sourced from PubChem (CID 175694166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).