About 6-(decylamino)hexanamide
6-(decylamino)hexanamide (PubChem CID 13292350) has the molecular formula C16H34N2O
and a molecular weight of 270.46 g/mol. Its IUPAC name is 6-(decylamino)hexanamide.
Molecular Properties
| Compound Name | 6-(decylamino)hexanamide |
| PubChem CID | 13292350 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | 6-(decylamino)hexanamide |
| SMILES | CCCCCCCCCCNCCCCCC(N)=O |
| InChI | InChI=1S/C16H34N2O/c1-2-3-4-5-6-7-8-11-14-18-15-12-9-10-13-16(17)19/h18H,2-15H2,1H3,(H2,17,19) |
| InChIKey | VTBDHJGJHHHNTL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(decylamino)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(decylamino)hexanamide?
The IUPAC name of 6-(decylamino)hexanamide (CID 13292350) is 6-(decylamino)hexanamide.
What is the SMILES notation for 6-(decylamino)hexanamide?
The canonical SMILES for 6-(decylamino)hexanamide is CCCCCCCCCCNCCCCCC(N)=O.
What is the InChIKey of 6-(decylamino)hexanamide?
The InChIKey is VTBDHJGJHHHNTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34N2O/c1-2-3-4-5-6-7-8-11-14-18-15-12-9-10-13-16(17)19/h18H,2-15H2,1H3,(H2,17,19).
What are the key properties of 6-(decylamino)hexanamide?
6-(decylamino)hexanamide has a molecular weight of 270.46 g/mol, XLogP of 3.76, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(decylamino)hexanamide is sourced from PubChem (CID 13292350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).