About N-methylmethanamine;octadecanamide;propyl 2-hydroxypropanoate
N-methylmethanamine;octadecanamide;propyl 2-hydroxypropanoate (PubChem CID 87453878) has the molecular formula C26H56N2O4
and a molecular weight of 460.74 g/mol. Its IUPAC name is N-methylmethanamine;octadecanamide;propyl 2-hydroxypropanoate.
Molecular Properties
| Compound Name | N-methylmethanamine;octadecanamide;propyl 2-hydroxypropanoate |
| PubChem CID | 87453878 |
| Molecular Formula | C26H56N2O4 |
| Molecular Weight | 460.74 g/mol |
| Exact Mass | 460.42 |
| IUPAC Name | N-methylmethanamine;octadecanamide;propyl 2-hydroxypropanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(N)=O.CCCOC(=O)C(C)O.CNC |
| InChI | InChI=1S/C18H37NO.C6H12O3.C2H7N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-4-9-6(8)5(2)7;1-3-2/h2-17H2,1H3,(H2,19,20);5,7H,3-4H2,1-2H3;3H,1-2H3 |
| InChIKey | PZCACUNOHQTDDE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.74 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methylmethanamine;octadecanamide;propyl 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;octadecanamide;propyl 2-hydroxypropanoate?
The IUPAC name of N-methylmethanamine;octadecanamide;propyl 2-hydroxypropanoate (CID 87453878) is N-methylmethanamine;octadecanamide;propyl 2-hydroxypropanoate.
What is the SMILES notation for N-methylmethanamine;octadecanamide;propyl 2-hydroxypropanoate?
The canonical SMILES for N-methylmethanamine;octadecanamide;propyl 2-hydroxypropanoate is CCCCCCCCCCCCCCCCCC(N)=O.CCCOC(=O)C(C)O.CNC.
What is the InChIKey of N-methylmethanamine;octadecanamide;propyl 2-hydroxypropanoate?
The InChIKey is PZCACUNOHQTDDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO.C6H12O3.C2H7N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-4-9-6(8)5(2)7;1-3-2/h2-17H2,1H3,(H2,19,20);5,7H,3-4H2,1-2H3;3H,1-2H3.
What are the key properties of N-methylmethanamine;octadecanamide;propyl 2-hydroxypropanoate?
N-methylmethanamine;octadecanamide;propyl 2-hydroxypropanoate has a molecular weight of 460.74 g/mol, XLogP of 5.89, 19 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;octadecanamide;propyl 2-hydroxypropanoate is sourced from PubChem (CID 87453878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).