About lithium;hexadecyl 2-hydroxypropanoate;hydride
lithium;hexadecyl 2-hydroxypropanoate;hydride (PubChem CID 174573457) has the molecular formula C19H39LiO3
and a molecular weight of 322.46 g/mol. Its IUPAC name is lithium;hexadecyl 2-hydroxypropanoate;hydride.
Molecular Properties
| Compound Name | lithium;hexadecyl 2-hydroxypropanoate;hydride |
| PubChem CID | 174573457 |
| Molecular Formula | C19H39LiO3 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.31 |
| IUPAC Name | lithium;hexadecyl 2-hydroxypropanoate;hydride |
| SMILES | CCCCCCCCCCCCCCCCOC(=O)C(C)O.[H-].[Li+] |
| InChI | InChI=1S/C19H38O3.Li.H/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-19(21)18(2)20;;/h18,20H,3-17H2,1-2H3;;/q;+1;-1 |
| InChIKey | UJACDVRXZPHOMU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze lithium;hexadecyl 2-hydroxypropanoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hexadecyl 2-hydroxypropanoate;hydride?
The IUPAC name of lithium;hexadecyl 2-hydroxypropanoate;hydride (CID 174573457) is lithium;hexadecyl 2-hydroxypropanoate;hydride.
What is the SMILES notation for lithium;hexadecyl 2-hydroxypropanoate;hydride?
The canonical SMILES for lithium;hexadecyl 2-hydroxypropanoate;hydride is CCCCCCCCCCCCCCCCOC(=O)C(C)O.[H-].[Li+].
What is the InChIKey of lithium;hexadecyl 2-hydroxypropanoate;hydride?
The InChIKey is UJACDVRXZPHOMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38O3.Li.H/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-19(21)18(2)20;;/h18,20H,3-17H2,1-2H3;;/q;+1;-1.
What are the key properties of lithium;hexadecyl 2-hydroxypropanoate;hydride?
lithium;hexadecyl 2-hydroxypropanoate;hydride has a molecular weight of 322.46 g/mol, XLogP of 2.51, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hexadecyl 2-hydroxypropanoate;hydride is sourced from PubChem (CID 174573457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).