About decyl 2-methylhexanoate
decyl 2-methylhexanoate (PubChem CID 86220664) has the molecular formula C17H34O2
and a molecular weight of 270.46 g/mol. Its IUPAC name is decyl 2-methylhexanoate.
Molecular Properties
| Compound Name | decyl 2-methylhexanoate |
| PubChem CID | 86220664 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | decyl 2-methylhexanoate |
| SMILES | CCCCCCCCCCOC(=O)C(C)CCCC |
| InChI | InChI=1S/C17H34O2/c1-4-6-8-9-10-11-12-13-15-19-17(18)16(3)14-7-5-2/h16H,4-15H2,1-3H3 |
| InChIKey | VDAXXANQJGOYND-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decyl 2-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl 2-methylhexanoate?
The IUPAC name of decyl 2-methylhexanoate (CID 86220664) is decyl 2-methylhexanoate.
What is the SMILES notation for decyl 2-methylhexanoate?
The canonical SMILES for decyl 2-methylhexanoate is CCCCCCCCCCOC(=O)C(C)CCCC.
What is the InChIKey of decyl 2-methylhexanoate?
The InChIKey is VDAXXANQJGOYND-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O2/c1-4-6-8-9-10-11-12-13-15-19-17(18)16(3)14-7-5-2/h16H,4-15H2,1-3H3.
What are the key properties of decyl 2-methylhexanoate?
decyl 2-methylhexanoate has a molecular weight of 270.46 g/mol, XLogP of 5.50, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decyl 2-methylhexanoate is sourced from PubChem (CID 86220664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).